C10H16BrF3O — CID 82795107
2-bromo-1,1-dimethyl-4-(4,4,4-trifluorobutoxy)cyclobutane (PubChem CID 82795107) has the molecular formula C10H16BrF3O and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-bromo-1,1-dimethyl-4-(4,4,4-trifluorobutoxy)cyclobutane.
| Compound Name | 2-bromo-1,1-dimethyl-4-(4,4,4-trifluorobutoxy)cyclobutane |
|---|---|
| PubChem CID | 82795107 |
| Molecular Formula | C10H16BrF3O |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-bromo-1,1-dimethyl-4-(4,4,4-trifluorobutoxy)cyclobutane |
| SMILES | CC1(C)C(Br)CC1OCCCC(F)(F)F |
| InChI | InChI=1S/C10H16BrF3O/c1-9(2)7(11)6-8(9)15-5-3-4-10(12,13)14/h7-8H,3-6H2,1-2H3 |
| InChIKey | LDRYHDOFNPOEJU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|