C11H18F3N5O — CID 82795125
2-N,2-N-diethyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 82795125) has the molecular formula C11H18F3N5O and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 82795125 |
| Molecular Formula | C11H18F3N5O |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-N,2-N-diethyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1nc(N)nc(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H18F3N5O/c1-3-19(4-2)9-16-8(15)17-10(18-9)20-7-5-6-11(12,13)14/h3-7H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | BMMFAPQCEUCSCR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|