About 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide
3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide (PubChem CID 82795242) has the molecular formula C10H20F3NO3S
and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide |
| PubChem CID | 82795242 |
| Molecular Formula | C10H20F3NO3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide |
| SMILES | CC(C)C(COCCCC(F)(F)F)CS(N)(=O)=O |
| InChI | InChI=1S/C10H20F3NO3S/c1-8(2)9(7-18(14,15)16)6-17-5-3-4-10(11,12)13/h8-9H,3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | USUWULSSWXBTPG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide?
The IUPAC name of 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide (CID 82795242) is 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide.
What is the SMILES notation for 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide?
The canonical SMILES for 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide is CC(C)C(COCCCC(F)(F)F)CS(N)(=O)=O.
What is the InChIKey of 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide?
The InChIKey is USUWULSSWXBTPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO3S/c1-8(2)9(7-18(14,15)16)6-17-5-3-4-10(11,12)13/h8-9H,3-7H2,1-2H3,(H2,14,15,16).
What are the key properties of 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide?
3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide has a molecular weight of 291.34 g/mol, XLogP of 1.91, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide is sourced from PubChem (CID 82795242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).