C15H10Cl2FN — CID 82795364
1-[(2,6-dichlorophenyl)methyl]-4-fluoroindole (PubChem CID 82795364) has the molecular formula C15H10Cl2FN and a molecular weight of 294.16 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-4-fluoroindole.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-4-fluoroindole |
|---|---|
| PubChem CID | 82795364 |
| Molecular Formula | C15H10Cl2FN |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-4-fluoroindole |
| SMILES | Fc1cccc2c1ccn2Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H10Cl2FN/c16-12-3-1-4-13(17)11(12)9-19-8-7-10-14(18)5-2-6-15(10)19/h1-8H,9H2 |
| InChIKey | YKTMIXIZBCFRCC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |