About 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole
2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole (PubChem CID 827961) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole |
| PubChem CID | 827961 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole |
| SMILES | CC1(C)NN=C(c2ccccc2)S1 |
| InChI | InChI=1S/C10H12N2S/c1-10(2)12-11-9(13-10)8-6-4-3-5-7-8/h3-7,12H,1-2H3 |
| InChIKey | XEHACDOPECPCOK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole?
The IUPAC name of 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole (CID 827961) is 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole.
What is the SMILES notation for 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole?
The canonical SMILES for 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole is CC1(C)NN=C(c2ccccc2)S1.
What is the InChIKey of 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole?
The InChIKey is XEHACDOPECPCOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-10(2)12-11-9(13-10)8-6-4-3-5-7-8/h3-7,12H,1-2H3.
What are the key properties of 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole?
2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole has a molecular weight of 192.29 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-5-phenyl-3H-1,3,4-thiadiazole is sourced from PubChem (CID 827961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).