C12H12BrF3N2 — CID 82797615
3-bromo-4-[propyl(2,2,2-trifluoroethyl)amino]benzonitrile (PubChem CID 82797615) has the molecular formula C12H12BrF3N2 and a molecular weight of 321.14 g/mol. Its IUPAC name is 3-bromo-4-[propyl(2,2,2-trifluoroethyl)amino]benzonitrile.
| Compound Name | 3-bromo-4-[propyl(2,2,2-trifluoroethyl)amino]benzonitrile |
|---|---|
| PubChem CID | 82797615 |
| Molecular Formula | C12H12BrF3N2 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 3-bromo-4-[propyl(2,2,2-trifluoroethyl)amino]benzonitrile |
| SMILES | CCCN(CC(F)(F)F)c1ccc(C#N)cc1Br |
| InChI | InChI=1S/C12H12BrF3N2/c1-2-5-18(8-12(14,15)16)11-4-3-9(7-17)6-10(11)13/h3-4,6H,2,5,8H2,1H3 |
| InChIKey | LERJSDMKELJTPH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |