C16H18F2N2O — CID 82797779
N-(1-cyanocycloheptyl)-2,6-difluoro-3-methylbenzamide (PubChem CID 82797779) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-(1-cyanocycloheptyl)-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 82797779 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC2(C#N)CCCCCC2)c1F |
| InChI | InChI=1S/C16H18F2N2O/c1-11-6-7-12(17)13(14(11)18)15(21)20-16(10-19)8-4-2-3-5-9-16/h6-7H,2-5,8-9H2,1H3,(H,20,21) |
| InChIKey | FIXFJDCSULKZRW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |