C16H14BrF2NO — CID 82797938
N-[(3-bromophenyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide (PubChem CID 82797938) has the molecular formula C16H14BrF2NO and a molecular weight of 354.19 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 82797938 |
| Molecular Formula | C16H14BrF2NO |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2,6-difluoro-N,3-dimethylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(C)Cc2cccc(Br)c2)c1F |
| InChI | InChI=1S/C16H14BrF2NO/c1-10-6-7-13(18)14(15(10)19)16(21)20(2)9-11-4-3-5-12(17)8-11/h3-8H,9H2,1-2H3 |
| InChIKey | VOROZWUUNAIJFP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |