About 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile
3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile (PubChem CID 82798420) has the molecular formula C12H9BrClN3
and a molecular weight of 310.58 g/mol. Its IUPAC name is 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile |
| PubChem CID | 82798420 |
| Molecular Formula | C12H9BrClN3 |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile |
| SMILES | Cc1nn(-c2ccc(C#N)cc2Br)c(C)c1Cl |
| InChI | InChI=1S/C12H9BrClN3/c1-7-12(14)8(2)17(16-7)11-4-3-9(6-15)5-10(11)13/h3-5H,1-2H3 |
| InChIKey | VHUQYMCBWPUKLA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile?
The IUPAC name of 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile (CID 82798420) is 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile.
What is the SMILES notation for 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile?
The canonical SMILES for 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile is Cc1nn(-c2ccc(C#N)cc2Br)c(C)c1Cl.
What is the InChIKey of 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile?
The InChIKey is VHUQYMCBWPUKLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrClN3/c1-7-12(14)8(2)17(16-7)11-4-3-9(6-15)5-10(11)13/h3-5H,1-2H3.
What are the key properties of 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile?
3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile has a molecular weight of 310.58 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(4-chloro-3,5-dimethylpyrazol-1-yl)benzonitrile is sourced from PubChem (CID 82798420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).