About 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole
4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole (PubChem CID 828006) has the molecular formula C16H15N3
and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole |
| PubChem CID | 828006 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole |
| SMILES | c1ccc(CN2C3=NCCN3c3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N3/c1-2-6-13(7-3-1)12-19-15-9-5-4-8-14(15)18-11-10-17-16(18)19/h1-9H,10-12H2 |
| InChIKey | GDGPTJOHDWWUMQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole?
The IUPAC name of 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole (CID 828006) is 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole.
What is the SMILES notation for 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole?
The canonical SMILES for 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole is c1ccc(CN2C3=NCCN3c3ccccc32)cc1.
What is the InChIKey of 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole?
The InChIKey is GDGPTJOHDWWUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3/c1-2-6-13(7-3-1)12-19-15-9-5-4-8-14(15)18-11-10-17-16(18)19/h1-9H,10-12H2.
What are the key properties of 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole?
4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole has a molecular weight of 249.32 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1,2-dihydroimidazo[1,2-a]benzimidazole is sourced from PubChem (CID 828006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).