About 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol
1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol (PubChem CID 82800636) has the molecular formula C12H11BrFNOS
and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 82800636 |
| Molecular Formula | C12H11BrFNOS |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 314.97 |
| IUPAC Name | 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol |
| SMILES | Cc1nc(-c2ccc(F)c(Br)c2)sc1C(C)O |
| InChI | InChI=1S/C12H11BrFNOS/c1-6-11(7(2)16)17-12(15-6)8-3-4-10(14)9(13)5-8/h3-5,7,16H,1-2H3 |
| InChIKey | CZIXNHZXEFWBQF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol (CID 82800636) is 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol is Cc1nc(-c2ccc(F)c(Br)c2)sc1C(C)O.
What is the InChIKey of 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol?
The InChIKey is CZIXNHZXEFWBQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrFNOS/c1-6-11(7(2)16)17-12(15-6)8-3-4-10(14)9(13)5-8/h3-5,7,16H,1-2H3.
What are the key properties of 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol?
1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol has a molecular weight of 316.20 g/mol, XLogP of 4.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-bromo-4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 82800636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).