C14H14BrFN4 — CID 82801875
[2-(3-bromo-4-fluorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine (PubChem CID 82801875) has the molecular formula C14H14BrFN4 and a molecular weight of 337.20 g/mol. Its IUPAC name is [2-(3-bromo-4-fluorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine.
| Compound Name | [2-(3-bromo-4-fluorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82801875 |
| Molecular Formula | C14H14BrFN4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [2-(3-bromo-4-fluorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccc(F)c(Br)c2)nc2c1CCCC2 |
| InChI | InChI=1S/C14H14BrFN4/c15-10-7-8(5-6-11(10)16)13-18-12-4-2-1-3-9(12)14(19-13)20-17/h5-7H,1-4,17H2,(H,18,19,20) |
| InChIKey | WFEGALYOHARKDN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|