C16H16ClFO — CID 82803178
2-(3-chloro-2-fluorophenyl)-1-(2,3-dimethylphenyl)ethanol (PubChem CID 82803178) has the molecular formula C16H16ClFO and a molecular weight of 278.75 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(2,3-dimethylphenyl)ethanol.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(2,3-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 82803178 |
| Molecular Formula | C16H16ClFO |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(2,3-dimethylphenyl)ethanol |
| SMILES | Cc1cccc(C(O)Cc2cccc(Cl)c2F)c1C |
| InChI | InChI=1S/C16H16ClFO/c1-10-5-3-7-13(11(10)2)15(19)9-12-6-4-8-14(17)16(12)18/h3-8,15,19H,9H2,1-2H3 |
| InChIKey | FJAXXDLWEPDXNZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |