C12H12BrN3S2 — CID 82804954
3-bromo-4-[1-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide (PubChem CID 82804954) has the molecular formula C12H12BrN3S2 and a molecular weight of 342.29 g/mol. Its IUPAC name is 3-bromo-4-[1-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[1-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82804954 |
| Molecular Formula | C12H12BrN3S2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 3-bromo-4-[1-(1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
| SMILES | CC(Nc1ccc(C(N)=S)cc1Br)c1nccs1 |
| InChI | InChI=1S/C12H12BrN3S2/c1-7(12-15-4-5-18-12)16-10-3-2-8(11(14)17)6-9(10)13/h2-7,16H,1H3,(H2,14,17) |
| InChIKey | CMVWRVMEAGMFPM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|