About 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide
3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide (PubChem CID 82805024) has the molecular formula C15H17BrN2S2
and a molecular weight of 369.35 g/mol. Its IUPAC name is 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide.
Molecular Properties
| Compound Name | 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide |
| PubChem CID | 82805024 |
| Molecular Formula | C15H17BrN2S2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide |
| SMILES | Cc1cc(C(C)Nc2ccc(C(N)=S)cc2Br)c(C)s1 |
| InChI | InChI=1S/C15H17BrN2S2/c1-8-6-12(10(3)20-8)9(2)18-14-5-4-11(15(17)19)7-13(14)16/h4-7,9,18H,1-3H3,(H2,17,19) |
| InChIKey | DZFQKQPWIHOPHA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide?
The IUPAC name of 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide (CID 82805024) is 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide.
What is the SMILES notation for 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide?
The canonical SMILES for 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide is Cc1cc(C(C)Nc2ccc(C(N)=S)cc2Br)c(C)s1.
What is the InChIKey of 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide?
The InChIKey is DZFQKQPWIHOPHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrN2S2/c1-8-6-12(10(3)20-8)9(2)18-14-5-4-11(15(17)19)7-13(14)16/h4-7,9,18H,1-3H3,(H2,17,19).
What are the key properties of 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide?
3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide has a molecular weight of 369.35 g/mol, XLogP of 4.93, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-[1-(2,5-dimethylthiophen-3-yl)ethylamino]benzenecarbothioamide is sourced from PubChem (CID 82805024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).