C14H14ClFN4 — CID 82805386
[2-[(3-chloro-2-fluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 82805386) has the molecular formula C14H14ClFN4 and a molecular weight of 292.75 g/mol. Its IUPAC name is [2-[(3-chloro-2-fluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(3-chloro-2-fluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82805386 |
| Molecular Formula | C14H14ClFN4 |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [2-[(3-chloro-2-fluorophenyl)methyl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(Cc2cccc(Cl)c2F)nc2c1CCC2 |
| InChI | InChI=1S/C14H14ClFN4/c15-10-5-1-3-8(13(10)16)7-12-18-11-6-2-4-9(11)14(19-12)20-17/h1,3,5H,2,4,6-7,17H2,(H,18,19,20) |
| InChIKey | PSBZLTOMISUMMS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|