C13H19ClFNO2S — CID 82805447
1-(3-chloro-2-fluorophenyl)-5-ethylsulfonylpentan-2-amine (PubChem CID 82805447) has the molecular formula C13H19ClFNO2S and a molecular weight of 307.82 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-5-ethylsulfonylpentan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-5-ethylsulfonylpentan-2-amine |
|---|---|
| PubChem CID | 82805447 |
| Molecular Formula | C13H19ClFNO2S |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-5-ethylsulfonylpentan-2-amine |
| SMILES | CCS(=O)(=O)CCCC(N)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C13H19ClFNO2S/c1-2-19(17,18)8-4-6-11(16)9-10-5-3-7-12(14)13(10)15/h3,5,7,11H,2,4,6,8-9,16H2,1H3 |
| InChIKey | VRPWUGUXBRINLU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |