C15H21FO2 — CID 82805530
1-(2-fluoro-3-methoxyphenyl)-2,5-dimethylcyclohexan-1-ol (PubChem CID 82805530) has the molecular formula C15H21FO2 and a molecular weight of 252.33 g/mol. Its IUPAC name is 1-(2-fluoro-3-methoxyphenyl)-2,5-dimethylcyclohexan-1-ol.
| Compound Name | 1-(2-fluoro-3-methoxyphenyl)-2,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 82805530 |
| Molecular Formula | C15H21FO2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(2-fluoro-3-methoxyphenyl)-2,5-dimethylcyclohexan-1-ol |
| SMILES | COc1cccc(C2(O)CC(C)CCC2C)c1F |
| InChI | InChI=1S/C15H21FO2/c1-10-7-8-11(2)15(17,9-10)12-5-4-6-13(18-3)14(12)16/h4-6,10-11,17H,7-9H2,1-3H3 |
| InChIKey | JQIFNVXYBWICNW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |