C12H13ClF4O — CID 82805654
1-(3-chloro-2-fluorophenyl)-6,6,6-trifluorohexan-2-ol (PubChem CID 82805654) has the molecular formula C12H13ClF4O and a molecular weight of 284.68 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 82805654 |
| Molecular Formula | C12H13ClF4O |
| Molecular Weight | 284.68 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-6,6,6-trifluorohexan-2-ol |
| SMILES | OC(CCCC(F)(F)F)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H13ClF4O/c13-10-5-1-3-8(11(10)14)7-9(18)4-2-6-12(15,16)17/h1,3,5,9,18H,2,4,6-7H2 |
| InChIKey | AOYSMCICMREAPC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |