C13H17ClFN — CID 82806050
1-(3-chloro-2-fluorophenyl)-3-cyclobutylpropan-2-amine (PubChem CID 82806050) has the molecular formula C13H17ClFN and a molecular weight of 241.74 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-cyclobutylpropan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-cyclobutylpropan-2-amine |
|---|---|
| PubChem CID | 82806050 |
| Molecular Formula | C13H17ClFN |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-cyclobutylpropan-2-amine |
| SMILES | NC(Cc1cccc(Cl)c1F)CC1CCC1 |
| InChI | InChI=1S/C13H17ClFN/c14-12-6-2-5-10(13(12)15)8-11(16)7-9-3-1-4-9/h2,5-6,9,11H,1,3-4,7-8,16H2 |
| InChIKey | CTPXRTDZKIGFMF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |