C14H10ClF4N — CID 82806473
2-(3-chloro-2-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine (PubChem CID 82806473) has the molecular formula C14H10ClF4N and a molecular weight of 303.69 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 82806473 |
| Molecular Formula | C14H10ClF4N |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(2,3,4-trifluorophenyl)ethanamine |
| SMILES | NC(Cc1cccc(Cl)c1F)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H10ClF4N/c15-9-3-1-2-7(12(9)17)6-11(20)8-4-5-10(16)14(19)13(8)18/h1-5,11H,6,20H2 |
| InChIKey | LUHPZKZEIMEERA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|