C13H10BrF2NS — CID 82809947
[3-bromo-4-(3,4-difluorophenyl)sulfanylphenyl]methanamine (PubChem CID 82809947) has the molecular formula C13H10BrF2NS and a molecular weight of 330.20 g/mol. Its IUPAC name is [3-bromo-4-(3,4-difluorophenyl)sulfanylphenyl]methanamine.
| Compound Name | [3-bromo-4-(3,4-difluorophenyl)sulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 82809947 |
| Molecular Formula | C13H10BrF2NS |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | [3-bromo-4-(3,4-difluorophenyl)sulfanylphenyl]methanamine |
| SMILES | NCc1ccc(Sc2ccc(F)c(F)c2)c(Br)c1 |
| InChI | InChI=1S/C13H10BrF2NS/c14-10-5-8(7-17)1-4-13(10)18-9-2-3-11(15)12(16)6-9/h1-6H,7,17H2 |
| InChIKey | NNYDBLWHEHFLQB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |