C12H16BrN3O — CID 82809979
3-bromo-4-[3-(methylamino)pyrrolidin-1-yl]benzamide (PubChem CID 82809979) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is 3-bromo-4-[3-(methylamino)pyrrolidin-1-yl]benzamide.
| Compound Name | 3-bromo-4-[3-(methylamino)pyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 82809979 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-bromo-4-[3-(methylamino)pyrrolidin-1-yl]benzamide |
| SMILES | CNC1CCN(c2ccc(C(N)=O)cc2Br)C1 |
| InChI | InChI=1S/C12H16BrN3O/c1-15-9-4-5-16(7-9)11-3-2-8(12(14)17)6-10(11)13/h2-3,6,9,15H,4-5,7H2,1H3,(H2,14,17) |
| InChIKey | RHGGWXPGNQFBRZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |