C14H17BrN2O — CID 82810399
3-bromo-4-[[1-(hydroxymethyl)cyclohexyl]amino]benzonitrile (PubChem CID 82810399) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 3-bromo-4-[[1-(hydroxymethyl)cyclohexyl]amino]benzonitrile.
| Compound Name | 3-bromo-4-[[1-(hydroxymethyl)cyclohexyl]amino]benzonitrile |
|---|---|
| PubChem CID | 82810399 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-bromo-4-[[1-(hydroxymethyl)cyclohexyl]amino]benzonitrile |
| SMILES | N#Cc1ccc(NC2(CO)CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C14H17BrN2O/c15-12-8-11(9-16)4-5-13(12)17-14(10-18)6-2-1-3-7-14/h4-5,8,17-18H,1-3,6-7,10H2 |
| InChIKey | VGFAKMHKHBJMBY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |