About 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid
3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid (PubChem CID 82811622) has the molecular formula C12H9Cl2N3O3S
and a molecular weight of 346.20 g/mol. Its IUPAC name is 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid.
Molecular Properties
| Compound Name | 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid |
| PubChem CID | 82811622 |
| Molecular Formula | C12H9Cl2N3O3S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1nccs1)Nc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N3O3S/c13-7-3-6(11(18)19)4-8(14)10(7)17-12(20)16-5-9-15-1-2-21-9/h1-4H,5H2,(H,18,19)(H2,16,17,20) |
| InChIKey | NCFOZIKOLSZEHF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid?
The IUPAC name of 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid (CID 82811622) is 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid.
What is the SMILES notation for 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid?
The canonical SMILES for 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid is O=C(NCc1nccs1)Nc1c(Cl)cc(C(=O)O)cc1Cl.
What is the InChIKey of 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid?
The InChIKey is NCFOZIKOLSZEHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2N3O3S/c13-7-3-6(11(18)19)4-8(14)10(7)17-12(20)16-5-9-15-1-2-21-9/h1-4H,5H2,(H,18,19)(H2,16,17,20).
What are the key properties of 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid?
3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid has a molecular weight of 346.20 g/mol, XLogP of 3.47, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-(1,3-thiazol-2-ylmethylcarbamoylamino)benzoic acid is sourced from PubChem (CID 82811622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).