C15H22N4 — CID 82812738
3-amino-2-(4-propylazepan-1-yl)pyridine-4-carbonitrile (PubChem CID 82812738) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-amino-2-(4-propylazepan-1-yl)pyridine-4-carbonitrile.
| Compound Name | 3-amino-2-(4-propylazepan-1-yl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 82812738 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3-amino-2-(4-propylazepan-1-yl)pyridine-4-carbonitrile |
| SMILES | CCCC1CCCN(c2nccc(C#N)c2N)CC1 |
| InChI | InChI=1S/C15H22N4/c1-2-4-12-5-3-9-19(10-7-12)15-14(17)13(11-16)6-8-18-15/h6,8,12H,2-5,7,9-10,17H2,1H3 |
| InChIKey | BMZNBNJEXAGRIE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |