C13H13Cl2N3O3 — CID 82813797
4-(4-amino-3,5-dichlorobenzoyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 82813797) has the molecular formula C13H13Cl2N3O3 and a molecular weight of 330.17 g/mol. Its IUPAC name is 4-(4-amino-3,5-dichlorobenzoyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(4-amino-3,5-dichlorobenzoyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 82813797 |
| Molecular Formula | C13H13Cl2N3O3 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-(4-amino-3,5-dichlorobenzoyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3O3/c1-13(2)12(21)17-9(19)5-18(13)11(20)6-3-7(14)10(16)8(15)4-6/h3-4H,5,16H2,1-2H3,(H,17,19,21) |
| InChIKey | OCOWXRJHUFKSNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|