About 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile
2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile (PubChem CID 82813994) has the molecular formula C12H11N5O2S
and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile |
| PubChem CID | 82813994 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile |
| SMILES | Cc1csc(C(C)Nc2nccc(C#N)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H11N5O2S/c1-7-6-20-12(15-7)8(2)16-11-10(17(18)19)9(5-13)3-4-14-11/h3-4,6,8H,1-2H3,(H,14,16) |
| InChIKey | HRIITOXRUYQWDW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile?
The IUPAC name of 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile (CID 82813994) is 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile.
What is the SMILES notation for 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile?
The canonical SMILES for 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile is Cc1csc(C(C)Nc2nccc(C#N)c2[N+](=O)[O-])n1.
What is the InChIKey of 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile?
The InChIKey is HRIITOXRUYQWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O2S/c1-7-6-20-12(15-7)8(2)16-11-10(17(18)19)9(5-13)3-4-14-11/h3-4,6,8H,1-2H3,(H,14,16).
What are the key properties of 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile?
2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile has a molecular weight of 289.32 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]-3-nitropyridine-4-carbonitrile is sourced from PubChem (CID 82813994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).