C16H17F2NO — CID 82814680
1-(2,6-difluoro-3-methylphenyl)-2-(3-methoxyphenyl)ethanamine (PubChem CID 82814680) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)-2-(3-methoxyphenyl)ethanamine.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)-2-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 82814680 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)-2-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(CC(N)c2c(F)ccc(C)c2F)c1 |
| InChI | InChI=1S/C16H17F2NO/c1-10-6-7-13(17)15(16(10)18)14(19)9-11-4-3-5-12(8-11)20-2/h3-8,14H,9,19H2,1-2H3 |
| InChIKey | AISBOIPDNACQCZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |