C15H11ClF2O — CID 82815251
2-(2-chlorophenyl)-1-(2,6-difluoro-3-methylphenyl)ethanone (PubChem CID 82815251) has the molecular formula C15H11ClF2O and a molecular weight of 280.70 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(2,6-difluoro-3-methylphenyl)ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-(2,6-difluoro-3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 82815251 |
| Molecular Formula | C15H11ClF2O |
| Molecular Weight | 280.70 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(2,6-difluoro-3-methylphenyl)ethanone |
| SMILES | Cc1ccc(F)c(C(=O)Cc2ccccc2Cl)c1F |
| InChI | InChI=1S/C15H11ClF2O/c1-9-6-7-12(17)14(15(9)18)13(19)8-10-4-2-3-5-11(10)16/h2-7H,8H2,1H3 |
| InChIKey | OVCOECVFAGBUKN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.70 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |