About 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline
2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline (PubChem CID 82816076) has the molecular formula C11H10F2N2O
and a molecular weight of 224.21 g/mol. Its IUPAC name is 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline |
| PubChem CID | 82816076 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline |
| SMILES | Cc1ccc(F)c(NCc2cnco2)c1F |
| InChI | InChI=1S/C11H10F2N2O/c1-7-2-3-9(12)11(10(7)13)15-5-8-4-14-6-16-8/h2-4,6,15H,5H2,1H3 |
| InChIKey | SMSSUGNHDPCTSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline?
The IUPAC name of 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline (CID 82816076) is 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline.
What is the SMILES notation for 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline?
The canonical SMILES for 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline is Cc1ccc(F)c(NCc2cnco2)c1F.
What is the InChIKey of 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline?
The InChIKey is SMSSUGNHDPCTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2O/c1-7-2-3-9(12)11(10(7)13)15-5-8-4-14-6-16-8/h2-4,6,15H,5H2,1H3.
What are the key properties of 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline?
2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline has a molecular weight of 224.21 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-3-methyl-N-(1,3-oxazol-5-ylmethyl)aniline is sourced from PubChem (CID 82816076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).