About N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide
N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide (PubChem CID 82816222) has the molecular formula C13H16ClF2NO
and a molecular weight of 275.73 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide.
Molecular Properties
| Compound Name | N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide |
| PubChem CID | 82816222 |
| Molecular Formula | C13H16ClF2NO |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)N(CCCl)C(C)C)c1F |
| InChI | InChI=1S/C13H16ClF2NO/c1-8(2)17(7-6-14)13(18)11-10(15)5-4-9(3)12(11)16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | QWDOVBICJCZGQR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide?
The IUPAC name of N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide (CID 82816222) is N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide.
What is the SMILES notation for N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide?
The canonical SMILES for N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide is Cc1ccc(F)c(C(=O)N(CCCl)C(C)C)c1F.
What is the InChIKey of N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide?
The InChIKey is QWDOVBICJCZGQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClF2NO/c1-8(2)17(7-6-14)13(18)11-10(15)5-4-9(3)12(11)16/h4-5,8H,6-7H2,1-3H3.
What are the key properties of N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide?
N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide has a molecular weight of 275.73 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloroethyl)-2,6-difluoro-3-methyl-N-propan-2-ylbenzamide is sourced from PubChem (CID 82816222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).