About 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile
3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile (PubChem CID 82816661) has the molecular formula C11H11N5S
and a molecular weight of 245.31 g/mol. Its IUPAC name is 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile |
| PubChem CID | 82816661 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile |
| SMILES | Cc1csc(CNc2nccc(C#N)c2N)n1 |
| InChI | InChI=1S/C11H11N5S/c1-7-6-17-9(16-7)5-15-11-10(13)8(4-12)2-3-14-11/h2-3,6H,5,13H2,1H3,(H,14,15) |
| InChIKey | VYXSGTCNFHHOJE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile?
The IUPAC name of 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile (CID 82816661) is 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile.
What is the SMILES notation for 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile?
The canonical SMILES for 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile is Cc1csc(CNc2nccc(C#N)c2N)n1.
What is the InChIKey of 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile?
The InChIKey is VYXSGTCNFHHOJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5S/c1-7-6-17-9(16-7)5-15-11-10(13)8(4-12)2-3-14-11/h2-3,6H,5,13H2,1H3,(H,14,15).
What are the key properties of 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile?
3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile has a molecular weight of 245.31 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[(4-methyl-1,3-thiazol-2-yl)methylamino]pyridine-4-carbonitrile is sourced from PubChem (CID 82816661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).