About 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile
3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile (PubChem CID 82817461) has the molecular formula C13H20N4
and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile |
| PubChem CID | 82817461 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile |
| SMILES | CC(N(C)c1nccc(C#N)c1N)C(C)(C)C |
| InChI | InChI=1S/C13H20N4/c1-9(13(2,3)4)17(5)12-11(15)10(8-14)6-7-16-12/h6-7,9H,15H2,1-5H3 |
| InChIKey | OIFPHPTWSQOAMZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile?
The IUPAC name of 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile (CID 82817461) is 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile.
What is the SMILES notation for 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile?
The canonical SMILES for 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile is CC(N(C)c1nccc(C#N)c1N)C(C)(C)C.
What is the InChIKey of 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile?
The InChIKey is OIFPHPTWSQOAMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4/c1-9(13(2,3)4)17(5)12-11(15)10(8-14)6-7-16-12/h6-7,9H,15H2,1-5H3.
What are the key properties of 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile?
3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile has a molecular weight of 232.33 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[3,3-dimethylbutan-2-yl(methyl)amino]pyridine-4-carbonitrile is sourced from PubChem (CID 82817461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).