C11H11F2N3 — CID 82819204
3-(2,6-difluoro-3-methylphenyl)-4-ethyl-1,2,4-triazole (PubChem CID 82819204) has the molecular formula C11H11F2N3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-(2,6-difluoro-3-methylphenyl)-4-ethyl-1,2,4-triazole.
| Compound Name | 3-(2,6-difluoro-3-methylphenyl)-4-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 82819204 |
| Molecular Formula | C11H11F2N3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-(2,6-difluoro-3-methylphenyl)-4-ethyl-1,2,4-triazole |
| SMILES | CCn1cnnc1-c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C11H11F2N3/c1-3-16-6-14-15-11(16)9-8(12)5-4-7(2)10(9)13/h4-6H,3H2,1-2H3 |
| InChIKey | NADPNXRJZSEKEW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |