About 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol
1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol (PubChem CID 82819317) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol |
| PubChem CID | 82819317 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol |
| SMILES | Cc1ccc(F)c(C(C)(O)CN)c1F |
| InChI | InChI=1S/C10H13F2NO/c1-6-3-4-7(11)8(9(6)12)10(2,14)5-13/h3-4,14H,5,13H2,1-2H3 |
| InChIKey | YWGFMMSDNJRWFR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol?
The IUPAC name of 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol (CID 82819317) is 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol.
What is the SMILES notation for 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol?
The canonical SMILES for 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol is Cc1ccc(F)c(C(C)(O)CN)c1F.
What is the InChIKey of 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol?
The InChIKey is YWGFMMSDNJRWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NO/c1-6-3-4-7(11)8(9(6)12)10(2,14)5-13/h3-4,14H,5,13H2,1-2H3.
What are the key properties of 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol?
1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol has a molecular weight of 201.22 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-(2,6-difluoro-3-methylphenyl)propan-2-ol is sourced from PubChem (CID 82819317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).