C12H6F6N2 — CID 82820207
N-(2,6-difluoro-3-methylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 82820207) has the molecular formula C12H6F6N2 and a molecular weight of 292.18 g/mol. Its IUPAC name is N-(2,6-difluoro-3-methylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-(2,6-difluoro-3-methylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 82820207 |
| Molecular Formula | C12H6F6N2 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-(2,6-difluoro-3-methylphenyl)-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Cc1ccc(F)c(Nc2c(F)c(F)nc(F)c2F)c1F |
| InChI | InChI=1S/C12H6F6N2/c1-4-2-3-5(13)9(6(4)14)19-10-7(15)11(17)20-12(18)8(10)16/h2-3H,1H3,(H,19,20) |
| InChIKey | VVIURYTUOYMSOE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|