C12H9F2NO2 — CID 82820386
N-(2,6-difluoro-3-methylphenyl)furan-2-carboxamide (PubChem CID 82820386) has the molecular formula C12H9F2NO2 and a molecular weight of 237.21 g/mol. Its IUPAC name is N-(2,6-difluoro-3-methylphenyl)furan-2-carboxamide.
| Compound Name | N-(2,6-difluoro-3-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82820386 |
| Molecular Formula | C12H9F2NO2 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-(2,6-difluoro-3-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2ccco2)c1F |
| InChI | InChI=1S/C12H9F2NO2/c1-7-4-5-8(13)11(10(7)14)15-12(16)9-3-2-6-17-9/h2-6H,1H3,(H,15,16) |
| InChIKey | GMYQXEFHYXQJEF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |