About [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol
[2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol (PubChem CID 82821252) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol |
| PubChem CID | 82821252 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol |
| SMILES | CC1(C)Cc2ccccc2C1Nc1ccccc1CO |
| InChI | InChI=1S/C18H21NO/c1-18(2)11-13-7-3-5-9-15(13)17(18)19-16-10-6-4-8-14(16)12-20/h3-10,17,19-20H,11-12H2,1-2H3 |
| InChIKey | XOZLBUOXNROBMU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol?
The IUPAC name of [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol (CID 82821252) is [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol.
What is the SMILES notation for [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol?
The canonical SMILES for [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol is CC1(C)Cc2ccccc2C1Nc1ccccc1CO.
What is the InChIKey of [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol?
The InChIKey is XOZLBUOXNROBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c1-18(2)11-13-7-3-5-9-15(13)17(18)19-16-10-6-4-8-14(16)12-20/h3-10,17,19-20H,11-12H2,1-2H3.
What are the key properties of [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol?
[2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol has a molecular weight of 267.37 g/mol, XLogP of 3.91, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,2-dimethyl-1,3-dihydroinden-1-yl)amino]phenyl]methanol is sourced from PubChem (CID 82821252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).