C10H17NO4 — CID 82821366
2,2-dimethyl-3-(oxan-4-ylamino)-3-oxopropanoic acid (PubChem CID 82821366) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2,2-dimethyl-3-(oxan-4-ylamino)-3-oxopropanoic acid.
| Compound Name | 2,2-dimethyl-3-(oxan-4-ylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82821366 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2,2-dimethyl-3-(oxan-4-ylamino)-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C10H17NO4/c1-10(2,9(13)14)8(12)11-7-3-5-15-6-4-7/h7H,3-6H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | CGSILLUOJONZII-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|