About N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine
N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine (PubChem CID 82821544) has the molecular formula C19H29N
and a molecular weight of 271.45 g/mol. Its IUPAC name is N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
| PubChem CID | 82821544 |
| Molecular Formula | C19H29N |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine |
| SMILES | CC1(C)Cc2ccccc2C1NCCC1CCCCC1 |
| InChI | InChI=1S/C19H29N/c1-19(2)14-16-10-6-7-11-17(16)18(19)20-13-12-15-8-4-3-5-9-15/h6-7,10-11,15,18,20H,3-5,8-9,12-14H2,1-2H3 |
| InChIKey | ZLZGCDRHNIJCSX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
The IUPAC name of N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine (CID 82821544) is N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine.
What is the SMILES notation for N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
The canonical SMILES for N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine is CC1(C)Cc2ccccc2C1NCCC1CCCCC1.
What is the InChIKey of N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
The InChIKey is ZLZGCDRHNIJCSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N/c1-19(2)14-16-10-6-7-11-17(16)18(19)20-13-12-15-8-4-3-5-9-15/h6-7,10-11,15,18,20H,3-5,8-9,12-14H2,1-2H3.
What are the key properties of N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine?
N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine has a molecular weight of 271.45 g/mol, XLogP of 4.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyclohexylethyl)-2,2-dimethyl-1,3-dihydroinden-1-amine is sourced from PubChem (CID 82821544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).