C14H8BrF2NO — CID 82825940
4-[(2-bromophenyl)methoxy]-3,5-difluorobenzonitrile (PubChem CID 82825940) has the molecular formula C14H8BrF2NO and a molecular weight of 324.12 g/mol. Its IUPAC name is 4-[(2-bromophenyl)methoxy]-3,5-difluorobenzonitrile.
| Compound Name | 4-[(2-bromophenyl)methoxy]-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 82825940 |
| Molecular Formula | C14H8BrF2NO |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 4-[(2-bromophenyl)methoxy]-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(OCc2ccccc2Br)c(F)c1 |
| InChI | InChI=1S/C14H8BrF2NO/c15-11-4-2-1-3-10(11)8-19-14-12(16)5-9(7-18)6-13(14)17/h1-6H,8H2 |
| InChIKey | KPGXUOPJSNPQMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |