C14H21BrO3 — CID 82826684
1-bromo-3-(3,3-diethoxypropoxymethyl)benzene (PubChem CID 82826684) has the molecular formula C14H21BrO3 and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-bromo-3-(3,3-diethoxypropoxymethyl)benzene.
| Compound Name | 1-bromo-3-(3,3-diethoxypropoxymethyl)benzene |
|---|---|
| PubChem CID | 82826684 |
| Molecular Formula | C14H21BrO3 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-bromo-3-(3,3-diethoxypropoxymethyl)benzene |
| SMILES | CCOC(CCOCc1cccc(Br)c1)OCC |
| InChI | InChI=1S/C14H21BrO3/c1-3-17-14(18-4-2)8-9-16-11-12-6-5-7-13(15)10-12/h5-7,10,14H,3-4,8-9,11H2,1-2H3 |
| InChIKey | VNHAHHMTDZQACZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|