About N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine
N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine (PubChem CID 82827774) has the molecular formula C15H19F2N
and a molecular weight of 251.32 g/mol. Its IUPAC name is N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine |
| PubChem CID | 82827774 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine |
| SMILES | C/C(=C/CCNC1CC1)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C15H19F2N/c1-10(4-3-9-18-12-6-7-12)14-13(16)8-5-11(2)15(14)17/h4-5,8,12,18H,3,6-7,9H2,1-2H3/b10-4- |
| InChIKey | UNXRRKMRVOMDLR-WMZJFQQLSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine?
The IUPAC name of N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine (CID 82827774) is N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine.
What is the SMILES notation for N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine?
The canonical SMILES for N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine is C/C(=C/CCNC1CC1)c1c(F)ccc(C)c1F.
What is the InChIKey of N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine?
The InChIKey is UNXRRKMRVOMDLR-WMZJFQQLSA-N. The full InChI is InChI=1S/C15H19F2N/c1-10(4-3-9-18-12-6-7-12)14-13(16)8-5-11(2)15(14)17/h4-5,8,12,18H,3,6-7,9H2,1-2H3/b10-4-.
What are the key properties of N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine?
N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine has a molecular weight of 251.32 g/mol, XLogP of 3.82, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4-(2,6-difluoro-3-methylphenyl)pent-3-enyl]cyclopropanamine is sourced from PubChem (CID 82827774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).