About N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine
N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine (PubChem CID 82827852) has the molecular formula C15H21F2N
and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine |
| PubChem CID | 82827852 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine |
| SMILES | Cc1ccc(F)c(C(C)C(C)CNC2CC2)c1F |
| InChI | InChI=1S/C15H21F2N/c1-9-4-7-13(16)14(15(9)17)11(3)10(2)8-18-12-5-6-12/h4,7,10-12,18H,5-6,8H2,1-3H3 |
| InChIKey | UUFLAJWQLHZFQT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine?
The IUPAC name of N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine (CID 82827852) is N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine.
What is the SMILES notation for N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine?
The canonical SMILES for N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine is Cc1ccc(F)c(C(C)C(C)CNC2CC2)c1F.
What is the InChIKey of N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine?
The InChIKey is UUFLAJWQLHZFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N/c1-9-4-7-13(16)14(15(9)17)11(3)10(2)8-18-12-5-6-12/h4,7,10-12,18H,5-6,8H2,1-3H3.
What are the key properties of N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine?
N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine has a molecular weight of 253.34 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,6-difluoro-3-methylphenyl)-2-methylbutyl]cyclopropanamine is sourced from PubChem (CID 82827852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).