About 2-phenylimidazo[1,2-a]quinoline
2-phenylimidazo[1,2-a]quinoline (PubChem CID 828287) has the molecular formula C17H12N2
and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-phenylimidazo[1,2-a]quinoline.
Molecular Properties
| Compound Name | 2-phenylimidazo[1,2-a]quinoline |
| PubChem CID | 828287 |
| Molecular Formula | C17H12N2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-phenylimidazo[1,2-a]quinoline |
| SMILES | c1ccc(-c2cn3c(ccc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C17H12N2/c1-2-6-13(7-3-1)15-12-19-16-9-5-4-8-14(16)10-11-17(19)18-15/h1-12H |
| InChIKey | FQJSDLFCFOISBV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylimidazo[1,2-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylimidazo[1,2-a]quinoline?
The IUPAC name of 2-phenylimidazo[1,2-a]quinoline (CID 828287) is 2-phenylimidazo[1,2-a]quinoline.
What is the SMILES notation for 2-phenylimidazo[1,2-a]quinoline?
The canonical SMILES for 2-phenylimidazo[1,2-a]quinoline is c1ccc(-c2cn3c(ccc4ccccc43)n2)cc1.
What is the InChIKey of 2-phenylimidazo[1,2-a]quinoline?
The InChIKey is FQJSDLFCFOISBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2/c1-2-6-13(7-3-1)15-12-19-16-9-5-4-8-14(16)10-11-17(19)18-15/h1-12H.
What are the key properties of 2-phenylimidazo[1,2-a]quinoline?
2-phenylimidazo[1,2-a]quinoline has a molecular weight of 244.30 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylimidazo[1,2-a]quinoline is sourced from PubChem (CID 828287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).