C14H16N2O3 — CID 82831134
2-methyl-3-[3-(oxolan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 82831134) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-methyl-3-[3-(oxolan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]phenol.
| Compound Name | 2-methyl-3-[3-(oxolan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 82831134 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-methyl-3-[3-(oxolan-2-ylmethyl)-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | Cc1c(O)cccc1-c1nc(CC2CCCO2)no1 |
| InChI | InChI=1S/C14H16N2O3/c1-9-11(5-2-6-12(9)17)14-15-13(16-19-14)8-10-4-3-7-18-10/h2,5-6,10,17H,3-4,7-8H2,1H3 |
| InChIKey | DHTOEAKDOJAWFC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |