C10H10BrN3OS — CID 82832131
5-[(3-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 82832131) has the molecular formula C10H10BrN3OS and a molecular weight of 300.18 g/mol. Its IUPAC name is 5-[(3-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82832131 |
| Molecular Formula | C10H10BrN3OS |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 5-[(3-bromophenyl)methoxymethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(COCc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C10H10BrN3OS/c11-8-3-1-2-7(4-8)5-15-6-9-13-14-10(12)16-9/h1-4H,5-6H2,(H2,12,14) |
| InChIKey | YLCOXPDKTJSOOF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |