C10H8Cl2N4O — CID 82832514
4-amino-3,5-dichloro-N-(1H-imidazol-2-yl)benzamide (PubChem CID 82832514) has the molecular formula C10H8Cl2N4O and a molecular weight of 271.11 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(1H-imidazol-2-yl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(1H-imidazol-2-yl)benzamide |
|---|---|
| PubChem CID | 82832514 |
| Molecular Formula | C10H8Cl2N4O |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(1H-imidazol-2-yl)benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)Nc2ncc[nH]2)cc1Cl |
| InChI | InChI=1S/C10H8Cl2N4O/c11-6-3-5(4-7(12)8(6)13)9(17)16-10-14-1-2-15-10/h1-4H,13H2,(H2,14,15,16,17) |
| InChIKey | NCOWYYSESSMQQO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|