C13H13Cl2N3OS — CID 82832587
4-amino-3,5-dichloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide (PubChem CID 82832587) has the molecular formula C13H13Cl2N3OS and a molecular weight of 330.24 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 82832587 |
| Molecular Formula | C13H13Cl2N3OS |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 4-amino-3,5-dichloro-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzamide |
| SMILES | Cc1ncsc1CN(C)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3OS/c1-7-11(20-6-17-7)5-18(2)13(19)8-3-9(14)12(16)10(15)4-8/h3-4,6H,5,16H2,1-2H3 |
| InChIKey | BQMASEDXLSLWET-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|